![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | C64/ | 2008-07-10 00:49 | - | |
| CMX/ | 2008-07-10 00:55 | - | |
| C Major Scale/ | 2008-07-10 00:49 | - | |
| CPM22/ | 2008-07-10 01:00 | - | |
| CRASH/ | 2008-07-10 01:01 | - | |
| CZD/ | 2008-07-10 01:04 | - | |
| Cabayo De Troya/ | 2008-07-10 00:49 | - | |
| Cabezones/ | 2008-07-10 00:49 | - | |
| Cabourg, Julien/ | 2008-07-10 00:49 | - | |
| Cabrel, Francis/ | 2008-07-10 00:49 | - | |
| Cachorro Grande/ | 2008-07-10 00:49 | - | |
| Cacophony/ | 2008-07-10 00:49 | - | |
| Cadaveria/ | 2008-07-10 00:49 | - | |
| Cadenza/ | 2008-07-10 00:49 | - | |
| Caesars/ | 2008-07-10 00:49 | - | |
| CafÇ Tacvba/ | 2008-07-10 00:49 | - | |
| Cagin, Gurhan/ | 2008-07-10 00:49 | - | |
| Caifanes/ | 2008-07-10 00:49 | - | |
| Caine/ | 2008-07-10 00:49 | - | |
| Cake/ | 2008-07-10 00:49 | - | |
| Calabresi, Fernando/ | 2008-07-10 00:49 | - | |
| Caladbolg, David/ | 2008-07-10 00:49 | - | |
| Calamaro, AndrÇs/ | 2008-07-10 00:49 | - | |
| Calamine/ | 2008-07-10 00:49 | - | |
| Calatayud, Bartolome/ | 2008-07-10 00:49 | - | |
| Calcanhotto, Adriana/ | 2008-07-10 00:49 | - | |
| Cale, JJ/ | 2008-07-10 00:49 | - | |
| Calexico/ | 2008-07-10 00:49 | - | |
| Cali/ | 2008-07-10 00:49 | - | |
| Caliban/ | 2008-07-10 00:49 | - | |
| California Guitar Trio/ | 2008-07-10 00:49 | - | |
| Call Us Junior's Project/ | 2008-07-10 00:49 | - | |
| Callejeros/ | 2008-07-10 00:49 | - | |
| Calling (The)/ | 2008-07-10 00:49 | - | |
| Call the Mayor/ | 2008-07-10 00:49 | - | |
| Calogero/ | 2008-07-10 00:49 | - | |
| CamÇlÇons (Les)/ | 2008-07-10 00:49 | - | |
| Camacho, Enrique/ | 2008-07-10 00:49 | - | |
| Cambefort, JP/ | 2008-07-10 00:49 | - | |
| Cambielli Guardian Marco/ | 2008-07-10 00:49 | - | |
| Camden/ | 2008-07-10 00:49 | - | |
| Camel/ | 2008-07-10 00:49 | - | |
| Camp Kill Yourself/ | 2008-07-10 00:50 | - | |
| Campanari/ | 2008-07-10 00:50 | - | |
| Campbell, Glenn/ | 2008-07-10 00:50 | - | |
| Can Ogan/ | 2008-07-10 00:50 | - | |
| Canada/ | 2008-07-10 00:50 | - | |
| Candemir, Koray/ | 2008-07-10 00:50 | - | |
| Candlebox/ | 2008-07-10 00:50 | - | |
| Candlemass/ | 2008-07-10 00:50 | - | |
| Candy Flavoured Blood/ | 2008-07-10 00:50 | - | |
| Canhoto/ | 2008-07-10 00:50 | - | |
| Canned Heat/ | 2008-07-10 00:50 | - | |
| Cannibal Corpse/ | 2008-07-10 00:50 | - | |
| Cannon, Gus/ | 2008-07-10 00:50 | - | |
| Cannon Fodder/ | 2008-07-10 00:50 | - | |
| Cano, Albert/ | 2008-07-10 00:50 | - | |
| Cano, Jose Maria/ | 2008-07-10 00:50 | - | |
| Cantrip/ | 2008-07-10 00:50 | - | |
| Caos/ | 2008-07-10 00:50 | - | |
| Capdown/ | 2008-07-10 00:50 | - | |
| Capi, Alex/ | 2008-07-10 00:50 | - | |
| Capital Inicial, Regis Luis/ | 2008-07-10 00:50 | - | |
| Capricornir, kourosh/ | 2008-07-10 00:50 | - | |
| Capua, Eduardo Di/ | 2008-07-10 00:50 | - | |
| Capulett/ | 2008-07-10 00:50 | - | |
| Carajo/ | 2008-07-10 00:50 | - | |
| Caramelos De Cianuro/ | 2008-07-10 00:50 | - | |
| Caranhac, Gilbert/ | 2008-07-10 00:50 | - | |
| Carapia, AndrÇs/ | 2008-07-10 00:50 | - | |
| Carbona/ | 2008-07-10 00:50 | - | |
| Carcariass/ | 2008-07-10 00:50 | - | |
| Carcass/ | 2008-07-10 00:51 | - | |
| Cardigans, The/ | 2008-07-10 00:51 | - | |
| Cardinal Sin/ | 2008-07-10 00:51 | - | |
| Cardoso, Jorge/ | 2008-07-10 00:51 | - | |
| CareBares/ | 2008-07-10 00:51 | - | |
| Carey, Mariah/ | 2008-07-10 00:51 | - | |
| Cargo/ | 2008-07-10 00:51 | - | |
| Carina Round/ | 2008-07-10 00:51 | - | |
| Carlisle, Belinda/ | 2008-07-10 00:51 | - | |
| Carlton, Larry/ | 2008-07-10 00:51 | - | |
| Carlton, Vanessa/ | 2008-07-10 00:51 | - | |
| Carlton E Chase, Carlton/ | 2008-07-10 00:51 | - | |
| Carmichael, Hoagy/ | 2008-07-10 00:51 | - | |
| Carnal Forge/ | 2008-07-10 00:51 | - | |
| Carnes, Kim/ | 2008-07-10 00:51 | - | |
| Carpark North/ | 2008-07-10 00:51 | - | |
| Carpathian Forest/ | 2008-07-10 00:51 | - | |
| Carpe Diem And Szymon Wydra (The)/ | 2008-07-10 00:51 | - | |
| Carpediem/ | 2008-07-10 00:51 | - | |
| Carpediocrastination/ | 2008-07-10 00:51 | - | |
| Carpenters (The)/ | 2008-07-10 00:51 | - | |
| Carranca/ | 2008-07-10 00:51 | - | |
| Carrara, Emile/ | 2008-07-10 00:51 | - | |
| Cars, The/ | 2008-07-10 00:51 | - | |
| Carter, Nick/ | 2008-07-10 00:51 | - | |
| Cartwright, Bernice/ | 2008-07-10 00:51 | - | |
| Carulli, Ferdinando/ | 2008-07-10 00:51 | - | |
| Casal, Luz/ | 2008-07-10 00:51 | - | |
| Casanova, Jose Miguel/ | 2008-07-10 00:51 | - | |
| Casanovas (The)/ | 2008-07-10 00:51 | - | |
| Casciotta, Vincent/ | 2008-07-10 00:51 | - | |
| Cash, Johnny/ | 2008-07-10 00:51 | - | |
| Casket Lottery (The)/ | 2008-07-10 00:51 | - | |
| Cassidy, Eva/ | 2008-07-10 00:51 | - | |
| Castelnuovo Tedesco, Mario/ | 2008-07-10 00:51 | - | |
| Casting Crowns/ | 2008-07-10 00:51 | - | |
| Castlevania/ | 2008-07-10 00:51 | - | |
| Castro, AndrÇ/ | 2008-07-10 00:51 | - | |
| Casualties (The)/ | 2008-07-10 00:51 | - | |
| Cat Power/ | 2008-07-10 00:51 | - | |
| Cat Stevens/ | 2008-07-10 00:51 | - | |
| Catalonia/ | 2008-07-10 00:51 | - | |
| Catamenia/ | 2008-07-10 00:51 | - | |
| Cataract/ | 2008-07-10 00:51 | - | |
| Catch 22/ | 2008-07-10 00:51 | - | |
| Catharsis/ | 2008-07-10 00:51 | - | |
| Cathedral/ | 2008-07-10 00:51 | - | |
| Cats, Stray/ | 2008-07-10 00:51 | - | |
| Cattle Decapitation/ | 2008-07-10 00:51 | - | |
| Cauterize/ | 2008-07-10 00:51 | - | |
| Cauvain, D/ | 2008-07-10 00:51 | - | |
| Cavaco/ | 2008-07-10 00:51 | - | |
| Cavaleiros Do Zodiaco, Os/ | 2008-07-10 00:51 | - | |
| Cazuza/ | 2008-07-10 00:51 | - | |
| Cbato/ | 2008-07-10 00:52 | - | |
| Celentano, Adriano/ | 2008-07-10 00:52 | - | |
| Celestia/ | 2008-07-10 00:52 | - | |
| Celtas Cortos/ | 2008-07-10 00:52 | - | |
| Celtic Frost/ | 2008-07-10 00:52 | - | |
| Celtica/ | 2008-07-10 00:52 | - | |
| Cem Karaca/ | 2008-07-10 00:52 | - | |
| Cem Kîksal/ | 2008-07-10 00:52 | - | |
| Cemetary/ | 2008-07-10 00:52 | - | |
| Cemetery Savage/ | 2008-07-10 00:52 | - | |
| Cepero, Paco/ | 2008-07-10 00:52 | - | |
| Cerati, Gustavo/ | 2008-07-10 00:52 | - | |
| Cerberoth/ | 2008-07-10 00:52 | - | |
| Cest Pas Sorcier/ | 2008-07-10 00:52 | - | |
| Cetin, Yavuz/ | 2008-07-10 00:52 | - | |
| Cha Boy/ | 2008-07-10 00:52 | - | |
| Chad Kroger and Josey Scott/ | 2008-07-10 00:52 | - | |
| Chaif/ | 2008-07-10 00:52 | - | |
| Chain Of Ponds/ | 2008-07-10 00:52 | - | |
| Chaka Khan/ | 2008-07-10 00:52 | - | |
| Chameleon/ | 2008-07-10 00:52 | - | |
| Chamfort, Alain/ | 2008-07-10 00:52 | - | |
| Chang/ | 2008-07-10 00:52 | - | |
| Chant Choral AlgÇrien/ | 2008-07-10 00:52 | - | |
| Chantays/ | 2008-07-10 00:52 | - | |
| Chaos/ | 2008-07-10 00:52 | - | |
| Chaos Opera/ | 2008-07-10 00:52 | - | |
| Chapin, Harry/ | 2008-07-10 00:52 | - | |
| Chapman, Matt & Mike/ | 2008-07-10 00:52 | - | |
| Chapman, Michael/ | 2008-07-10 00:52 | - | |
| Chapman, Steven Curtis/ | 2008-07-10 00:52 | - | |
| Chapman, Tracy/ | 2008-07-10 00:52 | - | |
| Charcoal/ | 2008-07-10 00:52 | - | |
| Charlatans/ | 2008-07-10 00:52 | - | |
| Charles, Ray/ | 2008-07-10 00:52 | - | |
| Charlie Brown Jr/ | 2008-07-10 00:52 | - | |
| Charly Garcia/ | 2008-07-10 00:52 | - | |
| Charon/ | 2008-07-10 00:52 | - | |
| Charta 77/ | 2008-07-10 00:52 | - | |
| Chassis/ | 2008-07-10 00:52 | - | |
| Chastain, David/ | 2008-07-10 00:52 | - | |
| Chateaux/ | 2008-07-10 00:52 | - | |
| Chaves E Chapolin/ | 2008-07-10 00:52 | - | |
| Cheap Trick/ | 2008-07-10 00:52 | - | |
| Cheb Hasni/ | 2008-07-10 00:52 | - | |
| Chedid, Louis/ | 2008-07-10 00:52 | - | |
| Cheech And Chong/ | 2008-07-10 00:52 | - | |
| Chemical Brothers (The)/ | 2008-07-10 00:52 | - | |
| Chernaya Metka, Gluki/ | 2008-07-10 00:52 | - | |
| Cherry Filter/ | 2008-07-10 00:52 | - | |
| Cherry Poppin Daddies/ | 2008-07-10 00:52 | - | |
| Cheung, Jacky/ | 2008-07-10 00:52 | - | |
| Chevelle/ | 2008-07-10 00:52 | - | |
| Chic, The/ | 2008-07-10 00:52 | - | |
| Chicago/ | 2008-07-10 00:52 | - | |
| Chico Buarque/ | 2008-07-10 00:52 | - | |
| Children Of Bodom/ | 2008-07-10 00:53 | - | |
| Children Of Boredom/ | 2008-07-10 00:53 | - | |
| Children of the Floyd/ | 2008-07-10 00:53 | - | |
| Chimaira/ | 2008-07-10 00:53 | - | |
| Chinese/ | 2008-07-10 00:53 | - | |
| Chingon/ | 2008-07-10 00:53 | - | |
| Chitan/ | 2008-07-10 00:53 | - | |
| Chitarra classica/ | 2008-07-10 00:53 | - | |
| Chizh & Co/ | 2008-07-10 00:53 | - | |
| Chlopcy z placu broni/ | 2008-07-10 00:53 | - | |
| Choke/ | 2008-07-10 00:53 | - | |
| Chokebore/ | 2008-07-10 00:53 | - | |
| Choking/ | 2008-07-10 00:53 | - | |
| Choking Victim/ | 2008-07-10 00:53 | - | |
| Chopin, Frederic/ | 2008-07-10 00:53 | - | |
| Chord forms & cycles/ | 2008-07-10 00:53 | - | |
| Chords/ | 2008-07-10 00:53 | - | |
| Choscos/ | 2008-07-10 00:53 | - | |
| Chow, Jay/ | 2008-07-10 00:53 | - | |
| Chris Cornell/ | 2008-07-10 00:53 | - | |
| Christ, Rotting/ | 2008-07-10 00:53 | - | |
| Christ Agony/ | 2008-07-10 00:53 | - | |
| Christensen, Tim/ | 2008-07-10 00:53 | - | |
| Christian, Charlie/ | 2008-07-10 00:54 | - | |
| Christian Epidemic/ | 2008-07-10 00:53 | - | |
| Christiani, HervÇ/ | 2008-07-10 00:54 | - | |
| Christina Aquilera/ | 2008-07-10 00:54 | - | |
| Christmas/ | 2008-07-10 00:54 | - | |
| Christofer Axelsson And The Genocide Riders/ | 2008-07-10 00:54 | - | |
| Chrizum/ | 2008-07-10 00:54 | - | |
| Chrono Cross/ | 2008-07-10 00:54 | - | |
| Chrono Trigger/ | 2008-07-10 00:54 | - | |
| Chronolium/ | 2008-07-10 00:54 | - | |
| Chubby, Poppa/ | 2008-07-10 00:54 | - | |
| Chudzik, Adrian/ | 2008-07-10 00:54 | - | |
| Chupa Cabra/ | 2008-07-10 00:54 | - | |
| Cimmerii/ | 2008-07-10 00:54 | - | |
| Cinderella/ | 2008-07-10 00:54 | - | |
| Cinerama/ | 2008-07-10 00:54 | - | |
| Circle II Circle/ | 2008-07-10 00:54 | - | |
| Circle Jerks (The)/ | 2008-07-10 00:54 | - | |
| Cirotil-X/ | 2008-07-10 00:54 | - | |
| Cky/ | 2008-07-10 00:54 | - | |
| ClÇment, Coralie/ | 2008-07-10 00:55 | - | |
| Clandestine Blaze/ | 2008-07-10 00:54 | - | |
| Clann Zu/ | 2008-07-10 00:54 | - | |
| Clap, the/ | 2008-07-10 00:54 | - | |
| Clapton, Eric/ | 2008-07-10 00:55 | - | |
| Clarke, Gilby/ | 2008-07-10 00:55 | - | |
| Clarke, Stanley/ | 2008-07-10 00:55 | - | |
| Clarkson, Kelly/ | 2008-07-10 00:55 | - | |
| Clash (The)/ | 2008-07-10 00:55 | - | |
| Class, First/ | 2008-07-10 00:55 | - | |
| Classic (The)/ | 2008-07-10 00:55 | - | |
| Classical Competition/ | 2008-07-10 00:55 | - | |
| Classical Competition 2/ | 2008-07-10 00:55 | - | |
| Classical Competition 3/ | 2008-07-10 00:55 | - | |
| Claux/ | 2008-07-10 00:55 | - | |
| Clawfinger/ | 2008-07-10 00:55 | - | |
| Clay/ | 2008-07-10 00:55 | - | |
| Clayderman, Richard/ | 2008-07-10 00:55 | - | |
| Clear (The)/ | 2008-07-10 00:55 | - | |
| Clement Peerens Explosition (The)/ | 2008-07-10 00:55 | - | |
| Clementi, Muzio/ | 2008-07-10 00:55 | - | |
| Clerc, Julien/ | 2008-07-10 00:55 | - | |
| Clockwork 7/ | 2008-07-10 00:55 | - | |
| Clone Inc/ | 2008-07-10 00:55 | - | |
| Closterkeller/ | 2008-07-10 00:55 | - | |
| Clutch/ | 2008-07-10 00:55 | - | |
| Coal Chamber/ | 2008-07-10 00:55 | - | |
| Coalesce/ | 2008-07-10 00:55 | - | |
| Coaltar Of The Deepers/ | 2008-07-10 00:55 | - | |
| Cob Web, Nepali/ | 2008-07-10 00:55 | - | |
| Cobian-Cadicamo/ | 2008-07-10 00:55 | - | |
| Cochran, Eddie/ | 2008-07-10 00:55 | - | |
| Cochrane, Tom/ | 2008-07-10 00:55 | - | |
| Cock Sparrer/ | 2008-07-10 00:55 | - | |
| Cocker, Joe/ | 2008-07-10 00:55 | - | |
| Cockney Rejects/ | 2008-07-10 00:55 | - | |
| Coda/ | 2008-07-10 00:55 | - | |
| Codigo Rojo/ | 2008-07-10 00:55 | - | |
| Coenen, Marcel/ | 2008-07-10 00:55 | - | |
| Coheed And Cambria/ | 2008-07-10 00:55 | - | |
| Cohen, Leonard/ | 2008-07-10 00:56 | - | |
| Cohn, Marc/ | 2008-07-10 00:56 | - | |
| Coil, Lacuna/ | 2008-07-10 00:56 | - | |
| Coir, A/ | 2008-07-10 00:56 | - | |
| Cold/ | 2008-07-10 00:56 | - | |
| Cold Blood/ | 2008-07-10 00:56 | - | |
| Cold Blood Animals/ | 2008-07-10 00:56 | - | |
| Cold Cast/ | 2008-07-10 00:56 | - | |
| Cold Meat/ | 2008-07-10 00:56 | - | |
| Coldplay/ | 2008-07-10 00:56 | - | |
| Collective Soul/ | 2008-07-10 00:56 | - | |
| College Fight Songs/ | 2008-07-10 00:56 | - | |
| Colley, Nick/ | 2008-07-10 00:56 | - | |
| Collins, Edwyn/ | 2008-07-10 00:56 | - | |
| Collins, Judy/ | 2008-07-10 00:56 | - | |
| Collins, Phil/ | 2008-07-10 00:56 | - | |
| Color Red (The)/ | 2008-07-10 00:56 | - | |
| Colour Of Fire/ | 2008-07-10 00:56 | - | |
| Coltrane, John/ | 2008-07-10 00:56 | - | |
| Coma/ | 2008-07-10 00:56 | - | |
| Comeback Kid/ | 2008-07-10 00:56 | - | |
| Comme Restus/ | 2008-07-10 00:56 | - | |
| Commonsense/ | 2008-07-10 00:56 | - | |
| Compagnie Creole (La)/ | 2008-07-10 00:56 | - | |
| Compagnie Lubat/ | 2008-07-10 00:56 | - | |
| Compay Segundo/ | 2008-07-10 00:56 | - | |
| Competition/ | 2008-07-10 00:57 | - | |
| Competition 2/ | 2008-07-10 00:57 | - | |
| Competition 3/ | 2008-07-10 00:57 | - | |
| Competition 4/ | 2008-07-10 00:57 | - | |
| Competition 5/ | 2008-07-10 00:57 | - | |
| Composers of MSB/ | 2008-07-10 00:59 | - | |
| Comstock, Frank/ | 2008-07-10 00:59 | - | |
| Comunidade Nin-Jitsu/ | 2008-07-10 00:59 | - | |
| Conception/ | 2008-07-10 00:59 | - | |
| Concrete Blonde/ | 2008-07-10 00:59 | - | |
| Confused/ | 2008-07-10 00:59 | - | |
| Cong Son, Trinh/ | 2008-07-10 00:59 | - | |
| Conic/ | 2008-07-10 00:59 | - | |
| Connells (The)/ | 2008-07-10 00:59 | - | |
| Conneries Pour Tickets/ | 2008-07-10 00:59 | - | |
| Conners, Jon/ | 2008-07-10 00:59 | - | |
| Consoli, Carmen/ | 2008-07-10 00:59 | - | |
| Continental Drift/ | 2008-07-10 00:59 | - | |
| Control Denied/ | 2008-07-10 00:59 | - | |
| Converge/ | 2008-07-10 00:59 | - | |
| Cooder, Ry/ | 2008-07-10 00:59 | - | |
| Cool Exercise/ | 2008-07-10 00:59 | - | |
| Cool Head Clan/ | 2008-07-10 00:59 | - | |
| Cool Kids Of Death/ | 2008-07-10 00:59 | - | |
| Cooley, Rusty/ | 2008-07-10 00:59 | - | |
| Coolio/ | 2008-07-10 00:59 | - | |
| Cooper, Brach/ | 2008-07-10 00:59 | - | |
| Cooper Temple Clause (The)/ | 2008-07-10 00:59 | - | |
| Copeland/ | 2008-07-10 00:59 | - | |
| Coquilles St Jacques, les/ | 2008-07-10 00:59 | - | |
| Coral (The)/ | 2008-07-10 00:59 | - | |
| Cordero, Ernesto/ | 2008-07-10 00:59 | - | |
| Cordes, Christian/ | 2008-07-10 00:59 | - | |
| Core/ | 2008-07-10 00:59 | - | |
| Corey Harris, Corey/ | 2008-07-10 00:59 | - | |
| Corneille/ | 2008-07-10 00:59 | - | |
| Cornershop/ | 2008-07-10 00:59 | - | |
| Coroner/ | 2008-07-10 00:59 | - | |
| Corran Horn/ | 2008-07-10 00:59 | - | |
| Corries (The)/ | 2008-07-10 00:59 | - | |
| Corrosion Of Conformity/ | 2008-07-10 00:59 | - | |
| Corrs (The)/ | 2008-07-10 00:59 | - | |
| Corruption/ | 2008-07-10 00:59 | - | |
| Corsis/ | 2008-07-10 00:59 | - | |
| Corte Final, O/ | 2008-07-10 00:59 | - | |
| Coryell, Larry/ | 2008-07-10 00:59 | - | |
| Cosma, Vladimir/ | 2008-07-10 00:59 | - | |
| Costello, Elvis/ | 2008-07-10 00:59 | - | |
| Cotten, Elizabeth/ | 2008-07-10 00:59 | - | |
| Counting Crows/ | 2008-07-10 00:59 | - | |
| Country Licks/ | 2008-07-10 00:59 | - | |
| Couperin, Franáois/ | 2008-07-10 00:59 | - | |
| Course Of Nature/ | 2008-07-10 00:59 | - | |
| Couscous/ | 2008-07-10 00:59 | - | |
| Cousins/ | 2008-07-10 00:59 | - | |
| Couture, CharlÇlie/ | 2008-07-10 00:59 | - | |
| Covenant/ | 2008-07-10 00:59 | - | |
| Coverares/ | 2008-07-10 00:59 | - | |
| Coverdale & Page/ | 2008-07-10 00:59 | - | |
| Cowboy Junkies/ | 2008-07-10 01:00 | - | |
| Cowboys Fringants/ | 2008-07-10 01:00 | - | |
| Cox, Jimmie/ | 2008-07-10 01:00 | - | |
| Cox/ | 2008-07-10 01:00 | - | |
| Coxon, Graham/ | 2008-07-10 01:00 | - | |
| Crack Ov Dawn/ | 2008-07-10 01:00 | - | |
| Crackers, The/ | 2008-07-10 01:00 | - | |
| Cracknell, Debbie/ | 2008-07-10 01:00 | - | |
| Cradle Of Filth/ | 2008-07-10 01:01 | - | |
| Cramps (The)/ | 2008-07-10 01:01 | - | |
| Cranberries/ | 2008-07-10 01:01 | - | |
| Crash Palace/ | 2008-07-10 01:01 | - | |
| Crash Test Dummies (The)/ | 2008-07-10 01:01 | - | |
| Crass/ | 2008-07-10 01:01 | - | |
| Cray, Robert/ | 2008-07-10 01:01 | - | |
| Crazy Competition/ | 2008-07-10 01:01 | - | |
| Crazy Town/ | 2008-07-10 01:01 | - | |
| Crazy Trains/ | 2008-07-10 01:01 | - | |
| Creaciones/ | 2008-07-10 01:01 | - | |
| Cream/ | 2008-07-10 01:02 | - | |
| Creber, Fabian/ | 2008-07-10 01:02 | - | |
| Creed/ | 2008-07-10 01:02 | - | |
| Creedence Clearwater Revival/ | 2008-07-10 01:02 | - | |
| Crematory/ | 2008-07-10 01:02 | - | |
| Crems/ | 2008-07-10 01:02 | - | |
| Crime Fighting Monkey/ | 2008-07-10 01:02 | - | |
| Criminal/ | 2008-07-10 01:02 | - | |
| Crimson Crystal/ | 2008-07-10 01:02 | - | |
| Crionics/ | 2008-07-10 01:02 | - | |
| Crispell, Marilyn/ | 2008-07-10 01:02 | - | |
| Cristal Eyes/ | 2008-07-10 01:02 | - | |
| Croatian Traditionnal Songs/ | 2008-07-10 01:02 | - | |
| Croce, Jim/ | 2008-07-10 01:02 | - | |
| Crocketts (The)/ | 2008-07-10 01:02 | - | |
| Cromok, The/ | 2008-07-10 01:02 | - | |
| Cropper, John/ | 2008-07-10 01:02 | - | |
| Crosby, Stills, Nash & Young/ | 2008-07-10 01:02 | - | |
| Cross, Cristopher/ | 2008-07-10 01:02 | - | |
| Crossfade/ | 2008-07-10 01:02 | - | |
| Crow, Sheryl/ | 2008-07-10 01:03 | - | |
| Crowded House/ | 2008-07-10 01:03 | - | |
| Crown (The)/ | 2008-07-10 01:03 | - | |
| Cruachan/ | 2008-07-10 01:03 | - | |
| Crucifire Moon/ | 2008-07-10 01:03 | - | |
| Crusaders/ | 2008-07-10 01:03 | - | |
| Crvena Jabuka/ | 2008-07-10 01:03 | - | |
| Cryhavoc/ | 2008-07-10 01:03 | - | |
| Crying Nut/ | 2008-07-10 01:03 | - | |
| Cryptic Myth/ | 2008-07-10 01:03 | - | |
| Cryptic Wintermoon/ | 2008-07-10 01:03 | - | |
| Cryptopsy/ | 2008-07-10 01:03 | - | |
| Crystal Ball/ | 2008-07-10 01:03 | - | |
| Cu Ba, Vu Khuc/ | 2008-07-10 01:03 | - | |
| Cuban/ | 2008-07-10 01:03 | - | |
| Cuca (La)/ | 2008-07-10 01:03 | - | |
| Cuckovic, Igor/ | 2008-07-10 01:03 | - | |
| Cuecas Y Tonadas De Chile/ | 2008-07-10 01:03 | - | |
| Cui jian/ | 2008-07-10 01:03 | - | |
| Culpables Inocentes/ | 2008-07-10 01:03 | - | |
| Cult (The)/ | 2008-07-10 01:03 | - | |
| Cumbawamba/ | 2008-07-10 01:03 | - | |
| CunnilingÅe/ | 2008-07-10 01:03 | - | |
| Cure (The)/ | 2008-07-10 01:03 | - | |
| Curiel, Dean/ | 2008-07-10 01:03 | - | |
| Curious Rocker/ | 2008-07-10 01:03 | - | |
| Current 93/ | 2008-07-10 01:03 | - | |
| Currently Unsigned/ | 2008-07-10 01:03 | - | |
| Curse/ | 2008-07-10 01:04 | - | |
| Cursed Seal/ | 2008-07-10 01:04 | - | |
| Cursive/ | 2008-07-10 01:04 | - | |
| Curtis, Ernesto de/ | 2008-07-10 01:04 | - | |
| Curtis Loew Band, The/ | 2008-07-10 01:04 | - | |
| Cutting Edge/ | 2008-07-10 01:04 | - | |
| Cyber Water Monkey Killers/ | 2008-07-10 01:04 | - | |
| Cyberskeida/ | 2008-07-10 01:04 | - | |
| Cynic/ | 2008-07-10 01:04 | - | |
| Cypress Hill/ | 2008-07-10 01:04 | - | |
| Czarno Czarni/ | 2008-07-10 01:04 | - | |
| cristian garrido/ | 2008-07-10 01:02 | - | |
|
|---|